C14H20N2O3 — CID 117415452
3-amino-1-[3-methoxy-4-(1-methylazetidin-3-yl)oxyphenyl]propan-1-one (PubChem CID 117415452) has the molecular formula C14H20N2O3 and a molecular weight of 264.32 g/mol. Its IUPAC name is 3-amino-1-[3-methoxy-4-(1-methylazetidin-3-yl)oxyphenyl]propan-1-one.
| Compound Name | 3-amino-1-[3-methoxy-4-(1-methylazetidin-3-yl)oxyphenyl]propan-1-one |
|---|---|
| PubChem CID | 117415452 |
| Molecular Formula | C14H20N2O3 |
| Molecular Weight | 264.32 g/mol |
| Exact Mass | 264.15 |
| IUPAC Name | 3-amino-1-[3-methoxy-4-(1-methylazetidin-3-yl)oxyphenyl]propan-1-one |
| SMILES | COc1cc(C(=O)CCN)ccc1OC1CN(C)C1 |
| InChI | InChI=1S/C14H20N2O3/c1-16-8-11(9-16)19-13-4-3-10(7-14(13)18-2)12(17)5-6-15/h3-4,7,11H,5-6,8-9,15H2,1-2H3 |
| InChIKey | AWEYTNMAQIBCSI-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 64.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.32 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |