C31H30N2O — CID 19749649
N-[4-[(E)-3-[4-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,9,11,13-heptaenylidene)piperidin-1-yl]prop-1-enyl]phenyl]acetamide (PubChem CID 19749649) has the molecular formula C31H30N2O and a molecular weight of 446.59 g/mol. Its IUPAC name is N-[4-[(E)-3-[4-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,9,11,13-heptaenylidene)piperidin-1-yl]prop-1-enyl]phenyl]acetamide.
| Compound Name | N-[4-[(E)-3-[4-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,9,11,13-heptaenylidene)piperidin-1-yl]prop-1-enyl]phenyl]acetamide |
|---|---|
| PubChem CID | 19749649 |
| Molecular Formula | C31H30N2O |
| Molecular Weight | 446.59 g/mol |
| Exact Mass | 446.24 |
| IUPAC Name | N-[4-[(E)-3-[4-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,9,11,13-heptaenylidene)piperidin-1-yl]prop-1-enyl]phenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(/C=C/CN2CCC(=C3c4ccccc4C=Cc4ccccc43)CC2)cc1 |
| InChI | InChI=1S/C31H30N2O/c1-23(34)32-28-16-12-24(13-17-28)7-6-20-33-21-18-27(19-22-33)31-29-10-4-2-8-25(29)14-15-26-9-3-5-11-30(26)31/h2-17H,18-22H2,1H3,(H,32,34)/b7-6+ |
| InChIKey | JJUIJXSRBVCIAW-VOTSOKGWSA-N |
| XLogP | 6.74 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.59 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|