C29H31ClN2O2S — CID 11386619
4-[(E)-3-[4-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaenylidene)piperidin-1-yl]prop-1-enyl]benzenesulfonamide;hydrochloride (PubChem CID 11386619) has the molecular formula C29H31ClN2O2S and a molecular weight of 507.10 g/mol. Its IUPAC name is 4-[(E)-3-[4-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaenylidene)piperidin-1-yl]prop-1-enyl]benzenesulfonamide;hydrochloride.
| Compound Name | 4-[(E)-3-[4-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaenylidene)piperidin-1-yl]prop-1-enyl]benzenesulfonamide;hydrochloride |
|---|---|
| PubChem CID | 11386619 |
| Molecular Formula | C29H31ClN2O2S |
| Molecular Weight | 507.10 g/mol |
| Exact Mass | 506.18 |
| IUPAC Name | 4-[(E)-3-[4-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaenylidene)piperidin-1-yl]prop-1-enyl]benzenesulfonamide;hydrochloride |
| SMILES | Cl.NS(=O)(=O)c1ccc(/C=C/CN2CCC(=C3c4ccccc4CCc4ccccc43)CC2)cc1 |
| InChI | InChI=1S/C29H30N2O2S.ClH/c30-34(32,33)26-15-11-22(12-16-26)6-5-19-31-20-17-25(18-21-31)29-27-9-3-1-7-23(27)13-14-24-8-2-4-10-28(24)29;/h1-12,15-16H,13-14,17-21H2,(H2,30,32,33);1H/b6-5+; |
| InChIKey | JMIXHEPZKZSWPB-IPZCTEOASA-N |
| XLogP | 5.47 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.10 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'styrene_A(13)', 'substructure': 'N/A'} |
|---|