C15H32N4O — CID 43253086
2-[4-(5-aminopentyl)piperazin-1-yl]-N-(2-methylpropyl)acetamide (PubChem CID 43253086) has the molecular formula C15H32N4O and a molecular weight of 284.45 g/mol. Its IUPAC name is 2-[4-(5-aminopentyl)piperazin-1-yl]-N-(2-methylpropyl)acetamide.
| Compound Name | 2-[4-(5-aminopentyl)piperazin-1-yl]-N-(2-methylpropyl)acetamide |
|---|---|
| PubChem CID | 43253086 |
| Molecular Formula | C15H32N4O |
| Molecular Weight | 284.45 g/mol |
| Exact Mass | 284.26 |
| IUPAC Name | 2-[4-(5-aminopentyl)piperazin-1-yl]-N-(2-methylpropyl)acetamide |
| SMILES | CC(C)CNC(=O)CN1CCN(CCCCCN)CC1 |
| InChI | InChI=1S/C15H32N4O/c1-14(2)12-17-15(20)13-19-10-8-18(9-11-19)7-5-3-4-6-16/h14H,3-13,16H2,1-2H3,(H,17,20) |
| InChIKey | OESFJKROWPJXJN-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 61.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.45 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|