C11H23N5O2 — CID 43252755
2-[4-(4-aminobutyl)piperazin-1-yl]-N-carbamoylacetamide (PubChem CID 43252755) has the molecular formula C11H23N5O2 and a molecular weight of 257.34 g/mol. Its IUPAC name is 2-[4-(4-aminobutyl)piperazin-1-yl]-N-carbamoylacetamide.
| Compound Name | 2-[4-(4-aminobutyl)piperazin-1-yl]-N-carbamoylacetamide |
|---|---|
| PubChem CID | 43252755 |
| Molecular Formula | C11H23N5O2 |
| Molecular Weight | 257.34 g/mol |
| Exact Mass | 257.19 |
| IUPAC Name | 2-[4-(4-aminobutyl)piperazin-1-yl]-N-carbamoylacetamide |
| SMILES | NCCCCN1CCN(CC(=O)NC(N)=O)CC1 |
| InChI | InChI=1S/C11H23N5O2/c12-3-1-2-4-15-5-7-16(8-6-15)9-10(17)14-11(13)18/h1-9,12H2,(H3,13,14,17,18) |
| InChIKey | SYKIXMZFLVHWPT-UHFFFAOYSA-N |
| XLogP | -1.46 |
| TPSA | 104.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.34 |
| LogP ≤ 5 | -1.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|