C13H27N5O2 — CID 43253136
2-[4-(5-aminopentyl)-1,4-diazepan-1-yl]-N-carbamoylacetamide (PubChem CID 43253136) has the molecular formula C13H27N5O2 and a molecular weight of 285.39 g/mol. Its IUPAC name is 2-[4-(5-aminopentyl)-1,4-diazepan-1-yl]-N-carbamoylacetamide.
| Compound Name | 2-[4-(5-aminopentyl)-1,4-diazepan-1-yl]-N-carbamoylacetamide |
|---|---|
| PubChem CID | 43253136 |
| Molecular Formula | C13H27N5O2 |
| Molecular Weight | 285.39 g/mol |
| Exact Mass | 285.22 |
| IUPAC Name | 2-[4-(5-aminopentyl)-1,4-diazepan-1-yl]-N-carbamoylacetamide |
| SMILES | NCCCCCN1CCCN(CC(=O)NC(N)=O)CC1 |
| InChI | InChI=1S/C13H27N5O2/c14-5-2-1-3-6-17-7-4-8-18(10-9-17)11-12(19)16-13(15)20/h1-11,14H2,(H3,15,16,19,20) |
| InChIKey | QLQTUKUZWFPBRU-UHFFFAOYSA-N |
| XLogP | -0.68 |
| TPSA | 104.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.39 |
| LogP ≤ 5 | -0.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|