C12H27N3O — CID 43253174
2-[4-(5-aminopentyl)-1,4-diazepan-1-yl]ethanol (PubChem CID 43253174) has the molecular formula C12H27N3O and a molecular weight of 229.37 g/mol. Its IUPAC name is 2-[4-(5-aminopentyl)-1,4-diazepan-1-yl]ethanol.
| Compound Name | 2-[4-(5-aminopentyl)-1,4-diazepan-1-yl]ethanol |
|---|---|
| PubChem CID | 43253174 |
| Molecular Formula | C12H27N3O |
| Molecular Weight | 229.37 g/mol |
| Exact Mass | 229.22 |
| IUPAC Name | 2-[4-(5-aminopentyl)-1,4-diazepan-1-yl]ethanol |
| SMILES | NCCCCCN1CCCN(CCO)CC1 |
| InChI | InChI=1S/C12H27N3O/c13-5-2-1-3-6-14-7-4-8-15(10-9-14)11-12-16/h16H,1-13H2 |
| InChIKey | DPFYODQKLSOPBL-UHFFFAOYSA-N |
| XLogP | 0.12 |
| TPSA | 52.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.37 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|