C12H24F3N3 — CID 43253140
5-[4-(2,2,2-trifluoroethyl)-1,4-diazepan-1-yl]pentan-1-amine (PubChem CID 43253140) has the molecular formula C12H24F3N3 and a molecular weight of 267.34 g/mol. Its IUPAC name is 5-[4-(2,2,2-trifluoroethyl)-1,4-diazepan-1-yl]pentan-1-amine.
| Compound Name | 5-[4-(2,2,2-trifluoroethyl)-1,4-diazepan-1-yl]pentan-1-amine |
|---|---|
| PubChem CID | 43253140 |
| Molecular Formula | C12H24F3N3 |
| Molecular Weight | 267.34 g/mol |
| Exact Mass | 267.19 |
| IUPAC Name | 5-[4-(2,2,2-trifluoroethyl)-1,4-diazepan-1-yl]pentan-1-amine |
| SMILES | NCCCCCN1CCCN(CC(F)(F)F)CC1 |
| InChI | InChI=1S/C12H24F3N3/c13-12(14,15)11-18-8-4-7-17(9-10-18)6-3-1-2-5-16/h1-11,16H2 |
| InChIKey | FQBYUMKYGMTOOR-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 32.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.34 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|