C7H14N2O5 — CID 175946093
(2S,3R)-3-hydroxy-2-[[(2S)-2-(hydroxyamino)propanoyl]amino]butanoic acid (PubChem CID 175946093) has the molecular formula C7H14N2O5 and a molecular weight of 206.20 g/mol. Its IUPAC name is (2S,3R)-3-hydroxy-2-[[(2S)-2-(hydroxyamino)propanoyl]amino]butanoic acid.
| Compound Name | (2S,3R)-3-hydroxy-2-[[(2S)-2-(hydroxyamino)propanoyl]amino]butanoic acid |
|---|---|
| PubChem CID | 175946093 |
| Molecular Formula | C7H14N2O5 |
| Molecular Weight | 206.20 g/mol |
| Exact Mass | 206.09 |
| IUPAC Name | (2S,3R)-3-hydroxy-2-[[(2S)-2-(hydroxyamino)propanoyl]amino]butanoic acid |
| SMILES | C[C@H](NO)C(=O)N[C@H](C(=O)O)[C@@H](C)O |
| InChI | InChI=1S/C7H14N2O5/c1-3(9-14)6(11)8-5(4(2)10)7(12)13/h3-5,9-10,14H,1-2H3,(H,8,11)(H,12,13)/t3-,4+,5-/m0/s1 |
| InChIKey | POKKJHYDHDJSBU-LMVFSUKVSA-N |
| XLogP | -1.70 |
| TPSA | 118.89 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.20 |
| LogP ≤ 5 | -1.70 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|