C10H19NO5 — CID 87298828
3-(1-carboxyethoxy)-4-(trimethylazaniumyl)butanoate (PubChem CID 87298828) has the molecular formula C10H19NO5 and a molecular weight of 233.26 g/mol. Its IUPAC name is 3-(1-carboxyethoxy)-4-(trimethylazaniumyl)butanoate.
| Compound Name | 3-(1-carboxyethoxy)-4-(trimethylazaniumyl)butanoate |
|---|---|
| PubChem CID | 87298828 |
| Molecular Formula | C10H19NO5 |
| Molecular Weight | 233.26 g/mol |
| Exact Mass | 233.13 |
| IUPAC Name | 3-(1-carboxyethoxy)-4-(trimethylazaniumyl)butanoate |
| SMILES | CC(OC(CC(=O)[O-])C[N+](C)(C)C)C(=O)O |
| InChI | InChI=1S/C10H19NO5/c1-7(10(14)15)16-8(5-9(12)13)6-11(2,3)4/h7-8H,5-6H2,1-4H3,(H-,12,13,14,15) |
| InChIKey | CXBJTOUFXCAWNI-UHFFFAOYSA-N |
| XLogP | -1.31 |
| TPSA | 86.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.26 |
| LogP ≤ 5 | -1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|