C12H24NO4+ — CID 12905282
(2-acetyloxy-4-oxo-4-propan-2-yloxybutyl)-trimethylazanium (PubChem CID 12905282) has the molecular formula C12H24NO4+ and a molecular weight of 246.33 g/mol. Its IUPAC name is (2-acetyloxy-4-oxo-4-propan-2-yloxybutyl)-trimethylazanium.
| Compound Name | (2-acetyloxy-4-oxo-4-propan-2-yloxybutyl)-trimethylazanium |
|---|---|
| PubChem CID | 12905282 |
| Molecular Formula | C12H24NO4+ |
| Molecular Weight | 246.33 g/mol |
| Exact Mass | 246.17 |
| IUPAC Name | (2-acetyloxy-4-oxo-4-propan-2-yloxybutyl)-trimethylazanium |
| SMILES | CC(=O)OC(CC(=O)OC(C)C)C[N+](C)(C)C |
| InChI | InChI=1S/C12H24NO4/c1-9(2)16-12(15)7-11(17-10(3)14)8-13(4,5)6/h9,11H,7-8H2,1-6H3/q+1 |
| InChIKey | CEZJVRGIZQYDIY-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.33 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|