C16H26NO8+ — CID 126501440
[(2R)-2-acetyloxy-4-[2-[(E)-4-methoxy-4-oxobut-2-enoyl]oxyethoxy]-4-oxobutyl]-trimethylazanium (PubChem CID 126501440) has the molecular formula C16H26NO8+ and a molecular weight of 360.38 g/mol. Its IUPAC name is [(2R)-2-acetyloxy-4-[2-[(E)-4-methoxy-4-oxobut-2-enoyl]oxyethoxy]-4-oxobutyl]-trimethylazanium.
| Compound Name | [(2R)-2-acetyloxy-4-[2-[(E)-4-methoxy-4-oxobut-2-enoyl]oxyethoxy]-4-oxobutyl]-trimethylazanium |
|---|---|
| PubChem CID | 126501440 |
| Molecular Formula | C16H26NO8+ |
| Molecular Weight | 360.38 g/mol |
| Exact Mass | 360.17 |
| IUPAC Name | [(2R)-2-acetyloxy-4-[2-[(E)-4-methoxy-4-oxobut-2-enoyl]oxyethoxy]-4-oxobutyl]-trimethylazanium |
| SMILES | COC(=O)/C=C/C(=O)OCCOC(=O)C[C@H](C[N+](C)(C)C)OC(C)=O |
| InChI | InChI=1S/C16H26NO8/c1-12(18)25-13(11-17(2,3)4)10-16(21)24-9-8-23-15(20)7-6-14(19)22-5/h6-7,13H,8-11H2,1-5H3/q+1/b7-6+/t13-/m1/s1 |
| InChIKey | RKQUWAABCXJAJU-KTRBRXNASA-N |
| XLogP | -0.17 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.38 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|