C11H20ClNO4 — CID 88619330
(2-acetyloxy-4-ethenoxy-4-oxobutyl)-trimethylazanium chloride (PubChem CID 88619330) has the molecular formula C11H20ClNO4 and a molecular weight of 265.74 g/mol. Its IUPAC name is (2-acetyloxy-4-ethenoxy-4-oxobutyl)-trimethylazanium chloride.
| Compound Name | (2-acetyloxy-4-ethenoxy-4-oxobutyl)-trimethylazanium chloride |
|---|---|
| PubChem CID | 88619330 |
| Molecular Formula | C11H20ClNO4 |
| Molecular Weight | 265.74 g/mol |
| Exact Mass | 265.11 |
| IUPAC Name | (2-acetyloxy-4-ethenoxy-4-oxobutyl)-trimethylazanium chloride |
| SMILES | C=COC(=O)CC(C[N+](C)(C)C)OC(C)=O.[Cl-] |
| InChI | InChI=1S/C11H20NO4.ClH/c1-6-15-11(14)7-10(16-9(2)13)8-12(3,4)5;/h6,10H,1,7-8H2,2-5H3;1H/q+1;/p-1 |
| InChIKey | JLPZPAQMNHHGOM-UHFFFAOYSA-M |
| XLogP | -2.29 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.74 |
| LogP ≤ 5 | -2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|