C11H24ClN2O5+ — CID 174606906
[(2S)-2-[(2S,3R)-2-amino-3-hydroxybutanoyl]oxy-3-carboxypropyl]-trimethylazanium;hydrochloride (PubChem CID 174606906) has the molecular formula C11H24ClN2O5+ and a molecular weight of 299.78 g/mol. Its IUPAC name is [(2S)-2-[(2S,3R)-2-amino-3-hydroxybutanoyl]oxy-3-carboxypropyl]-trimethylazanium;hydrochloride.
| Compound Name | [(2S)-2-[(2S,3R)-2-amino-3-hydroxybutanoyl]oxy-3-carboxypropyl]-trimethylazanium;hydrochloride |
|---|---|
| PubChem CID | 174606906 |
| Molecular Formula | C11H24ClN2O5+ |
| Molecular Weight | 299.78 g/mol |
| Exact Mass | 299.14 |
| IUPAC Name | [(2S)-2-[(2S,3R)-2-amino-3-hydroxybutanoyl]oxy-3-carboxypropyl]-trimethylazanium;hydrochloride |
| SMILES | C[C@@H](O)[C@H](N)C(=O)O[C@@H](CC(=O)O)C[N+](C)(C)C.Cl |
| InChI | InChI=1S/C11H22N2O5.ClH/c1-7(14)10(12)11(17)18-8(5-9(15)16)6-13(2,3)4;/h7-8,10,14H,5-6,12H2,1-4H3;1H/p+1/t7-,8+,10+;/m1./s1 |
| InChIKey | SRVPDIKFNUDHND-QVUDESDKSA-O |
| XLogP | -0.79 |
| TPSA | 109.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.78 |
| LogP ≤ 5 | -0.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|