C16H32NO4+ — CID 53477824
[3-carboxy-2-(2,6-dimethylheptanoyloxy)propyl]-trimethylazanium (PubChem CID 53477824) has the molecular formula C16H32NO4+ and a molecular weight of 302.44 g/mol. Its IUPAC name is [3-carboxy-2-(2,6-dimethylheptanoyloxy)propyl]-trimethylazanium.
| Compound Name | [3-carboxy-2-(2,6-dimethylheptanoyloxy)propyl]-trimethylazanium |
|---|---|
| PubChem CID | 53477824 |
| Molecular Formula | C16H32NO4+ |
| Molecular Weight | 302.44 g/mol |
| Exact Mass | 302.23 |
| IUPAC Name | [3-carboxy-2-(2,6-dimethylheptanoyloxy)propyl]-trimethylazanium |
| SMILES | CC(C)CCCC(C)C(=O)OC(CC(=O)O)C[N+](C)(C)C |
| InChI | InChI=1S/C16H31NO4/c1-12(2)8-7-9-13(3)16(20)21-14(10-15(18)19)11-17(4,5)6/h12-14H,7-11H2,1-6H3/p+1 |
| InChIKey | QBYXBONNCVATNQ-UHFFFAOYSA-O |
| XLogP | 2.54 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.44 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|