C26H52NO4+ — CID 156961147
[3-carboxy-2-(2,6,10,14-tetramethylpentadecanoyloxy)propyl]-trimethylazanium (PubChem CID 156961147) has the molecular formula C26H52NO4+ and a molecular weight of 442.71 g/mol. Its IUPAC name is [3-carboxy-2-(2,6,10,14-tetramethylpentadecanoyloxy)propyl]-trimethylazanium.
| Compound Name | [3-carboxy-2-(2,6,10,14-tetramethylpentadecanoyloxy)propyl]-trimethylazanium |
|---|---|
| PubChem CID | 156961147 |
| Molecular Formula | C26H52NO4+ |
| Molecular Weight | 442.71 g/mol |
| Exact Mass | 442.39 |
| IUPAC Name | [3-carboxy-2-(2,6,10,14-tetramethylpentadecanoyloxy)propyl]-trimethylazanium |
| SMILES | CC(C)CCCC(C)CCCC(C)CCCC(C)C(=O)OC(CC(=O)O)C[N+](C)(C)C |
| InChI | InChI=1S/C26H51NO4/c1-20(2)12-9-13-21(3)14-10-15-22(4)16-11-17-23(5)26(30)31-24(18-25(28)29)19-27(6,7)8/h20-24H,9-19H2,1-8H3/p+1 |
| InChIKey | HMCQEDBUNXULMS-UHFFFAOYSA-O |
| XLogP | 6.15 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.71 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|