C12H24NO4S+ — CID 167380961
[(2R)-2-tert-butylsulfanylcarbonyloxy-3-carboxypropyl]-trimethylazanium (PubChem CID 167380961) has the molecular formula C12H24NO4S+ and a molecular weight of 278.39 g/mol. Its IUPAC name is [(2R)-2-tert-butylsulfanylcarbonyloxy-3-carboxypropyl]-trimethylazanium.
| Compound Name | [(2R)-2-tert-butylsulfanylcarbonyloxy-3-carboxypropyl]-trimethylazanium |
|---|---|
| PubChem CID | 167380961 |
| Molecular Formula | C12H24NO4S+ |
| Molecular Weight | 278.39 g/mol |
| Exact Mass | 278.14 |
| IUPAC Name | [(2R)-2-tert-butylsulfanylcarbonyloxy-3-carboxypropyl]-trimethylazanium |
| SMILES | CC(C)(C)SC(=O)O[C@H](CC(=O)O)C[N+](C)(C)C |
| InChI | InChI=1S/C12H23NO4S/c1-12(2,3)18-11(16)17-9(7-10(14)15)8-13(4,5)6/h9H,7-8H2,1-6H3/p+1/t9-/m1/s1 |
| InChIKey | RPFZTSLCUJFFHL-SECBINFHSA-O |
| XLogP | 2.20 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.39 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|