C16H33ClN2O6 — CID 174438411
2-amino-3-methylpentanoic acid;3-propanoyloxy-4-(trimethylazaniumyl)butanoate;hydrochloride (PubChem CID 174438411) has the molecular formula C16H33ClN2O6 and a molecular weight of 384.90 g/mol. Its IUPAC name is 2-amino-3-methylpentanoic acid;3-propanoyloxy-4-(trimethylazaniumyl)butanoate;hydrochloride.
| Compound Name | 2-amino-3-methylpentanoic acid;3-propanoyloxy-4-(trimethylazaniumyl)butanoate;hydrochloride |
|---|---|
| PubChem CID | 174438411 |
| Molecular Formula | C16H33ClN2O6 |
| Molecular Weight | 384.90 g/mol |
| Exact Mass | 384.20 |
| IUPAC Name | 2-amino-3-methylpentanoic acid;3-propanoyloxy-4-(trimethylazaniumyl)butanoate;hydrochloride |
| SMILES | CCC(=O)OC(CC(=O)[O-])C[N+](C)(C)C.CCC(C)C(N)C(=O)O.Cl |
| InChI | InChI=1S/C10H19NO4.C6H13NO2.ClH/c1-5-10(14)15-8(6-9(12)13)7-11(2,3)4;1-3-4(2)5(7)6(8)9;/h8H,5-7H2,1-4H3;4-5H,3,7H2,1-2H3,(H,8,9);1H |
| InChIKey | FRGVYIBGRGFSGA-UHFFFAOYSA-N |
| XLogP | 0.02 |
| TPSA | 129.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.90 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|