C16H29NO5 — CID 156962724
3-[(E)-6-hydroxynon-2-enoyl]oxy-4-(trimethylazaniumyl)butanoate (PubChem CID 156962724) has the molecular formula C16H29NO5 and a molecular weight of 315.41 g/mol. Its IUPAC name is 3-[(E)-6-hydroxynon-2-enoyl]oxy-4-(trimethylazaniumyl)butanoate.
| Compound Name | 3-[(E)-6-hydroxynon-2-enoyl]oxy-4-(trimethylazaniumyl)butanoate |
|---|---|
| PubChem CID | 156962724 |
| Molecular Formula | C16H29NO5 |
| Molecular Weight | 315.41 g/mol |
| Exact Mass | 315.20 |
| IUPAC Name | 3-[(E)-6-hydroxynon-2-enoyl]oxy-4-(trimethylazaniumyl)butanoate |
| SMILES | CCCC(O)CC/C=C/C(=O)OC(CC(=O)[O-])C[N+](C)(C)C |
| InChI | InChI=1S/C16H29NO5/c1-5-8-13(18)9-6-7-10-16(21)22-14(11-15(19)20)12-17(2,3)4/h7,10,13-14,18H,5-6,8-9,11-12H2,1-4H3/b10-7+ |
| InChIKey | MMYBNHMWRXYMKQ-JXMROGBWSA-N |
| XLogP | 0.24 |
| TPSA | 86.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.41 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|