C18H27NO6 — CID 156961733
3-[(2E,5E,7E)-10-carboxydeca-2,5,7-trienoyl]oxy-4-(trimethylazaniumyl)butanoate (PubChem CID 156961733) has the molecular formula C18H27NO6 and a molecular weight of 353.42 g/mol. Its IUPAC name is 3-[(2E,5E,7E)-10-carboxydeca-2,5,7-trienoyl]oxy-4-(trimethylazaniumyl)butanoate.
| Compound Name | 3-[(2E,5E,7E)-10-carboxydeca-2,5,7-trienoyl]oxy-4-(trimethylazaniumyl)butanoate |
|---|---|
| PubChem CID | 156961733 |
| Molecular Formula | C18H27NO6 |
| Molecular Weight | 353.42 g/mol |
| Exact Mass | 353.18 |
| IUPAC Name | 3-[(2E,5E,7E)-10-carboxydeca-2,5,7-trienoyl]oxy-4-(trimethylazaniumyl)butanoate |
| SMILES | C[N+](C)(C)CC(CC(=O)[O-])OC(=O)/C=C/C/C=C/C=C/CCC(=O)O |
| InChI | InChI=1S/C18H27NO6/c1-19(2,3)14-15(13-17(22)23)25-18(24)12-10-8-6-4-5-7-9-11-16(20)21/h4-7,10,12,15H,8-9,11,13-14H2,1-3H3,(H-,20,21,22,23)/b6-4+,7-5+,12-10+ |
| InChIKey | BFROTNJJYDEVST-QFUSUKIJSA-N |
| XLogP | 0.67 |
| TPSA | 103.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.42 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|