C21H37NO4 — CID 169446041
(3R)-3-[(2E,4E)-tetradeca-2,4-dienoyl]oxy-4-[tri((113C)methyl)azaniumyl]butanoate (PubChem CID 169446041) has the molecular formula C21H37NO4 and a molecular weight of 370.51 g/mol. Its IUPAC name is (3R)-3-[(2E,4E)-tetradeca-2,4-dienoyl]oxy-4-[tri((113C)methyl)azaniumyl]butanoate.
| Compound Name | (3R)-3-[(2E,4E)-tetradeca-2,4-dienoyl]oxy-4-[tri((113C)methyl)azaniumyl]butanoate |
|---|---|
| PubChem CID | 169446041 |
| Molecular Formula | C21H37NO4 |
| Molecular Weight | 370.51 g/mol |
| Exact Mass | 370.28 |
| IUPAC Name | (3R)-3-[(2E,4E)-tetradeca-2,4-dienoyl]oxy-4-[tri((113C)methyl)azaniumyl]butanoate |
| SMILES | CCCCCCCCC/C=C/C=C/C(=O)O[C@H](CC(=O)[O-])C[N+]([13CH3])([13CH3])[13CH3] |
| InChI | InChI=1S/C21H37NO4/c1-5-6-7-8-9-10-11-12-13-14-15-16-21(25)26-19(17-20(23)24)18-22(2,3)4/h13-16,19H,5-12,17-18H2,1-4H3/b14-13+,16-15+/t19-/m1/s1/i2+1,3+1,4+1 |
| InChIKey | DBJDCEJXEMUHGM-AULQIODZSA-N |
| XLogP | 3.00 |
| TPSA | 66.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.51 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|