C29H45NO4 — CID 57357158
3-docosa-2,4,6,8,10,12-hexaenoyloxy-4-(trimethylazaniumyl)butanoate (PubChem CID 57357158) has the molecular formula C29H45NO4 and a molecular weight of 471.68 g/mol. Its IUPAC name is 3-docosa-2,4,6,8,10,12-hexaenoyloxy-4-(trimethylazaniumyl)butanoate.
| Compound Name | 3-docosa-2,4,6,8,10,12-hexaenoyloxy-4-(trimethylazaniumyl)butanoate |
|---|---|
| PubChem CID | 57357158 |
| Molecular Formula | C29H45NO4 |
| Molecular Weight | 471.68 g/mol |
| Exact Mass | 471.33 |
| IUPAC Name | 3-docosa-2,4,6,8,10,12-hexaenoyloxy-4-(trimethylazaniumyl)butanoate |
| SMILES | CCCCCCCCCC=CC=CC=CC=CC=CC=CC(=O)OC(CC(=O)[O-])C[N+](C)(C)C |
| InChI | InChI=1S/C29H45NO4/c1-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-23-24-29(33)34-27(25-28(31)32)26-30(2,3)4/h13-24,27H,5-12,25-26H2,1-4H3 |
| InChIKey | MJYGZJOLZBPVBU-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 66.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.68 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|