C21H37NO5 — CID 156962094
3-[(4E,6E)-2-hydroxytetradeca-4,6-dienoyl]oxy-4-(trimethylazaniumyl)butanoate (PubChem CID 156962094) has the molecular formula C21H37NO5 and a molecular weight of 383.53 g/mol. Its IUPAC name is 3-[(4E,6E)-2-hydroxytetradeca-4,6-dienoyl]oxy-4-(trimethylazaniumyl)butanoate.
| Compound Name | 3-[(4E,6E)-2-hydroxytetradeca-4,6-dienoyl]oxy-4-(trimethylazaniumyl)butanoate |
|---|---|
| PubChem CID | 156962094 |
| Molecular Formula | C21H37NO5 |
| Molecular Weight | 383.53 g/mol |
| Exact Mass | 383.27 |
| IUPAC Name | 3-[(4E,6E)-2-hydroxytetradeca-4,6-dienoyl]oxy-4-(trimethylazaniumyl)butanoate |
| SMILES | CCCCCCC/C=C/C=C/CC(O)C(=O)OC(CC(=O)[O-])C[N+](C)(C)C |
| InChI | InChI=1S/C21H37NO5/c1-5-6-7-8-9-10-11-12-13-14-15-19(23)21(26)27-18(16-20(24)25)17-22(2,3)4/h11-14,18-19,23H,5-10,15-17H2,1-4H3/b12-11+,14-13+ |
| InChIKey | WIBWLOJWVYHSSD-LDHFCIDVSA-N |
| XLogP | 1.97 |
| TPSA | 86.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.53 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|