C21H39NO3 — CID 174998020
3-tetradeca-3,5-dienoxy-4-(trimethylazaniumyl)butanoate (PubChem CID 174998020) has the molecular formula C21H39NO3 and a molecular weight of 353.55 g/mol. Its IUPAC name is 3-tetradeca-3,5-dienoxy-4-(trimethylazaniumyl)butanoate.
| Compound Name | 3-tetradeca-3,5-dienoxy-4-(trimethylazaniumyl)butanoate |
|---|---|
| PubChem CID | 174998020 |
| Molecular Formula | C21H39NO3 |
| Molecular Weight | 353.55 g/mol |
| Exact Mass | 353.29 |
| IUPAC Name | 3-tetradeca-3,5-dienoxy-4-(trimethylazaniumyl)butanoate |
| SMILES | CCCCCCCCC=CC=CCCOC(CC(=O)[O-])C[N+](C)(C)C |
| InChI | InChI=1S/C21H39NO3/c1-5-6-7-8-9-10-11-12-13-14-15-16-17-25-20(18-21(23)24)19-22(2,3)4/h12-15,20H,5-11,16-19H2,1-4H3 |
| InChIKey | XRHIPLTUFDYPMN-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 49.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.55 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|