C32H62N2O6 — CID 174833737
3-hydroxy-4-(trimethylazaniumyl)butanoate;3-[(9Z,12Z)-octadeca-9,12-dienoxy]-4-(trimethylazaniumyl)butanoate (PubChem CID 174833737) has the molecular formula C32H62N2O6 and a molecular weight of 570.86 g/mol. Its IUPAC name is 3-hydroxy-4-(trimethylazaniumyl)butanoate;3-[(9Z,12Z)-octadeca-9,12-dienoxy]-4-(trimethylazaniumyl)butanoate.
| Compound Name | 3-hydroxy-4-(trimethylazaniumyl)butanoate;3-[(9Z,12Z)-octadeca-9,12-dienoxy]-4-(trimethylazaniumyl)butanoate |
|---|---|
| PubChem CID | 174833737 |
| Molecular Formula | C32H62N2O6 |
| Molecular Weight | 570.86 g/mol |
| Exact Mass | 570.46 |
| IUPAC Name | 3-hydroxy-4-(trimethylazaniumyl)butanoate;3-[(9Z,12Z)-octadeca-9,12-dienoxy]-4-(trimethylazaniumyl)butanoate |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCCOC(CC(=O)[O-])C[N+](C)(C)C.C[N+](C)(C)CC(O)CC(=O)[O-] |
| InChI | InChI=1S/C25H47NO3.C7H15NO3/c1-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-29-24(22-25(27)28)23-26(2,3)4;1-8(2,3)5-6(9)4-7(10)11/h9-10,12-13,24H,5-8,11,14-23H2,1-4H3;6,9H,4-5H2,1-3H3/b10-9-,13-12-; |
| InChIKey | CVXMAZHQIODDBI-SCNCTLMVSA-N |
| XLogP | 3.22 |
| TPSA | 109.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.86 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|