C17H25NO6 — CID 156961591
3-[(3E,5E,8E)-9-carboxynona-3,5,8-trienoyl]oxy-4-(trimethylazaniumyl)butanoate (PubChem CID 156961591) has the molecular formula C17H25NO6 and a molecular weight of 339.39 g/mol. Its IUPAC name is 3-[(3E,5E,8E)-9-carboxynona-3,5,8-trienoyl]oxy-4-(trimethylazaniumyl)butanoate.
| Compound Name | 3-[(3E,5E,8E)-9-carboxynona-3,5,8-trienoyl]oxy-4-(trimethylazaniumyl)butanoate |
|---|---|
| PubChem CID | 156961591 |
| Molecular Formula | C17H25NO6 |
| Molecular Weight | 339.39 g/mol |
| Exact Mass | 339.17 |
| IUPAC Name | 3-[(3E,5E,8E)-9-carboxynona-3,5,8-trienoyl]oxy-4-(trimethylazaniumyl)butanoate |
| SMILES | C[N+](C)(C)CC(CC(=O)[O-])OC(=O)C/C=C/C=C/C/C=C/C(=O)O |
| InChI | InChI=1S/C17H25NO6/c1-18(2,3)13-14(12-16(21)22)24-17(23)11-9-7-5-4-6-8-10-15(19)20/h4-5,7-10,14H,6,11-13H2,1-3H3,(H-,19,20,21,22)/b5-4+,9-7+,10-8+ |
| InChIKey | AHIUIYMBNXSIQH-OEXOILMYSA-N |
| XLogP | 0.28 |
| TPSA | 103.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.39 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|