C19H31NO6 — CID 156961844
3-[(5E,10E)-11-carboxyundeca-5,10-dienoyl]oxy-4-(trimethylazaniumyl)butanoate (PubChem CID 156961844) has the molecular formula C19H31NO6 and a molecular weight of 369.46 g/mol. Its IUPAC name is 3-[(5E,10E)-11-carboxyundeca-5,10-dienoyl]oxy-4-(trimethylazaniumyl)butanoate.
| Compound Name | 3-[(5E,10E)-11-carboxyundeca-5,10-dienoyl]oxy-4-(trimethylazaniumyl)butanoate |
|---|---|
| PubChem CID | 156961844 |
| Molecular Formula | C19H31NO6 |
| Molecular Weight | 369.46 g/mol |
| Exact Mass | 369.22 |
| IUPAC Name | 3-[(5E,10E)-11-carboxyundeca-5,10-dienoyl]oxy-4-(trimethylazaniumyl)butanoate |
| SMILES | C[N+](C)(C)CC(CC(=O)[O-])OC(=O)CCC/C=C/CCC/C=C/C(=O)O |
| InChI | InChI=1S/C19H31NO6/c1-20(2,3)15-16(14-18(23)24)26-19(25)13-11-9-7-5-4-6-8-10-12-17(21)22/h5,7,10,12,16H,4,6,8-9,11,13-15H2,1-3H3,(H-,21,22,23,24)/b7-5+,12-10+ |
| InChIKey | DLHAIIHAOJZDKU-WRRYRWARSA-N |
| XLogP | 1.28 |
| TPSA | 103.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.46 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|