C16H30NO4+ — CID 156962714
[3-carboxy-2-[(E)-non-2-enoyl]oxypropyl]-trimethylazanium (PubChem CID 156962714) has the molecular formula C16H30NO4+ and a molecular weight of 300.42 g/mol. Its IUPAC name is [3-carboxy-2-[(E)-non-2-enoyl]oxypropyl]-trimethylazanium.
| Compound Name | [3-carboxy-2-[(E)-non-2-enoyl]oxypropyl]-trimethylazanium |
|---|---|
| PubChem CID | 156962714 |
| Molecular Formula | C16H30NO4+ |
| Molecular Weight | 300.42 g/mol |
| Exact Mass | 300.22 |
| IUPAC Name | [3-carboxy-2-[(E)-non-2-enoyl]oxypropyl]-trimethylazanium |
| SMILES | CCCCCC/C=C/C(=O)OC(CC(=O)O)C[N+](C)(C)C |
| InChI | InChI=1S/C16H29NO4/c1-5-6-7-8-9-10-11-16(20)21-14(12-15(18)19)13-17(2,3)4/h10-11,14H,5-9,12-13H2,1-4H3/p+1/b11-10+ |
| InChIKey | DHNUSRNSTBOTHN-ZHACJKMWSA-O |
| XLogP | 2.61 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.42 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|