C19H33NO7 — CID 156961794
3-[(Z)-11-carboxy-10-hydroxyundec-10-enoyl]oxy-4-(trimethylazaniumyl)butanoate (PubChem CID 156961794) has the molecular formula C19H33NO7 and a molecular weight of 387.47 g/mol. Its IUPAC name is 3-[(Z)-11-carboxy-10-hydroxyundec-10-enoyl]oxy-4-(trimethylazaniumyl)butanoate.
| Compound Name | 3-[(Z)-11-carboxy-10-hydroxyundec-10-enoyl]oxy-4-(trimethylazaniumyl)butanoate |
|---|---|
| PubChem CID | 156961794 |
| Molecular Formula | C19H33NO7 |
| Molecular Weight | 387.47 g/mol |
| Exact Mass | 387.23 |
| IUPAC Name | 3-[(Z)-11-carboxy-10-hydroxyundec-10-enoyl]oxy-4-(trimethylazaniumyl)butanoate |
| SMILES | C[N+](C)(C)CC(CC(=O)[O-])OC(=O)CCCCCCCC/C(O)=C/C(=O)O |
| InChI | InChI=1S/C19H33NO7/c1-20(2,3)14-16(13-18(24)25)27-19(26)11-9-7-5-4-6-8-10-15(21)12-17(22)23/h12,16H,4-11,13-14H2,1-3H3,(H2-,21,22,23,24,25)/b15-12- |
| InChIKey | JAJCAVLRKVZLPM-QINSGFPZSA-N |
| XLogP | 1.39 |
| TPSA | 123.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.47 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|