C15H27NO5 — CID 122538717
3-(3-hydroxyoct-2-enoyloxy)-4-(trimethylazaniumyl)butanoate (PubChem CID 122538717) has the molecular formula C15H27NO5 and a molecular weight of 301.38 g/mol. Its IUPAC name is 3-(3-hydroxyoct-2-enoyloxy)-4-(trimethylazaniumyl)butanoate.
| Compound Name | 3-(3-hydroxyoct-2-enoyloxy)-4-(trimethylazaniumyl)butanoate |
|---|---|
| PubChem CID | 122538717 |
| Molecular Formula | C15H27NO5 |
| Molecular Weight | 301.38 g/mol |
| Exact Mass | 301.19 |
| IUPAC Name | 3-(3-hydroxyoct-2-enoyloxy)-4-(trimethylazaniumyl)butanoate |
| SMILES | CCCCCC(O)=CC(=O)OC(CC(=O)[O-])C[N+](C)(C)C |
| InChI | InChI=1S/C15H27NO5/c1-5-6-7-8-12(17)9-15(20)21-13(10-14(18)19)11-16(2,3)4/h9,13H,5-8,10-11H2,1-4H3,(H-,17,18,19,20) |
| InChIKey | AGZVWTPAAPLHBD-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 86.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.38 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|