C15H24O12 — CID 91402691
4-[6-(3-carboxy-2,3-dihydroxypropanoyl)oxyheptoxy]-2,3-dihydroxy-4-oxobutanoic acid (PubChem CID 91402691) has the molecular formula C15H24O12 and a molecular weight of 396.35 g/mol. Its IUPAC name is 4-[6-(3-carboxy-2,3-dihydroxypropanoyl)oxyheptoxy]-2,3-dihydroxy-4-oxobutanoic acid.
| Compound Name | 4-[6-(3-carboxy-2,3-dihydroxypropanoyl)oxyheptoxy]-2,3-dihydroxy-4-oxobutanoic acid |
|---|---|
| PubChem CID | 91402691 |
| Molecular Formula | C15H24O12 |
| Molecular Weight | 396.35 g/mol |
| Exact Mass | 396.13 |
| IUPAC Name | 4-[6-(3-carboxy-2,3-dihydroxypropanoyl)oxyheptoxy]-2,3-dihydroxy-4-oxobutanoic acid |
| SMILES | CC(CCCCCOC(=O)C(O)C(O)C(=O)O)OC(=O)C(O)C(O)C(=O)O |
| InChI | InChI=1S/C15H24O12/c1-7(27-15(25)11(19)9(17)13(22)23)5-3-2-4-6-26-14(24)10(18)8(16)12(20)21/h7-11,16-19H,2-6H2,1H3,(H,20,21)(H,22,23) |
| InChIKey | NVEVENAYMDNNLK-UHFFFAOYSA-N |
| XLogP | -2.37 |
| TPSA | 208.12 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.35 |
| LogP ≤ 5 | -2.37 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|