C16H26O12 — CID 91206779
4-[5-(3-carboxy-2,3-dihydroxypropanoyl)oxyoctoxy]-2,3-dihydroxy-4-oxobutanoic acid (PubChem CID 91206779) has the molecular formula C16H26O12 and a molecular weight of 410.37 g/mol. Its IUPAC name is 4-[5-(3-carboxy-2,3-dihydroxypropanoyl)oxyoctoxy]-2,3-dihydroxy-4-oxobutanoic acid.
| Compound Name | 4-[5-(3-carboxy-2,3-dihydroxypropanoyl)oxyoctoxy]-2,3-dihydroxy-4-oxobutanoic acid |
|---|---|
| PubChem CID | 91206779 |
| Molecular Formula | C16H26O12 |
| Molecular Weight | 410.37 g/mol |
| Exact Mass | 410.14 |
| IUPAC Name | 4-[5-(3-carboxy-2,3-dihydroxypropanoyl)oxyoctoxy]-2,3-dihydroxy-4-oxobutanoic acid |
| SMILES | CCCC(CCCCOC(=O)C(O)C(O)C(=O)O)OC(=O)C(O)C(O)C(=O)O |
| InChI | InChI=1S/C16H26O12/c1-2-5-8(28-16(26)12(20)10(18)14(23)24)6-3-4-7-27-15(25)11(19)9(17)13(21)22/h8-12,17-20H,2-7H2,1H3,(H,21,22)(H,23,24) |
| InChIKey | OLAVGVIBSXQMRL-UHFFFAOYSA-N |
| XLogP | -1.98 |
| TPSA | 208.12 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.37 |
| LogP ≤ 5 | -1.98 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|