C6H14ClNO3 — CID 91621430
2-acetyloxy-N,N-dimethylethanamine oxide;hydrochloride (PubChem CID 91621430) has the molecular formula C6H14ClNO3 and a molecular weight of 183.63 g/mol. Its IUPAC name is 2-acetyloxy-N,N-dimethylethanamine oxide;hydrochloride.
| Compound Name | 2-acetyloxy-N,N-dimethylethanamine oxide;hydrochloride |
|---|---|
| PubChem CID | 91621430 |
| Molecular Formula | C6H14ClNO3 |
| Molecular Weight | 183.63 g/mol |
| Exact Mass | 183.07 |
| IUPAC Name | 2-acetyloxy-N,N-dimethylethanamine oxide;hydrochloride |
| SMILES | CC(=O)OCC[N+](C)(C)[O-].Cl |
| InChI | InChI=1S/C6H13NO3.ClH/c1-6(8)10-5-4-7(2,3)9;/h4-5H2,1-3H3;1H |
| InChIKey | DPFHMLKJCMMYPI-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 49.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.63 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|