C22H46BrN2O4+ — CID 54611939
2-acetyloxyethyl-[10-[2-acetyloxyethyl(dimethyl)azaniumyl]decyl]-dimethylazanium bromide (PubChem CID 54611939) has the molecular formula C22H46BrN2O4+ and a molecular weight of 482.52 g/mol. Its IUPAC name is 2-acetyloxyethyl-[10-[2-acetyloxyethyl(dimethyl)azaniumyl]decyl]-dimethylazanium bromide.
| Compound Name | 2-acetyloxyethyl-[10-[2-acetyloxyethyl(dimethyl)azaniumyl]decyl]-dimethylazanium bromide |
|---|---|
| PubChem CID | 54611939 |
| Molecular Formula | C22H46BrN2O4+ |
| Molecular Weight | 482.52 g/mol |
| Exact Mass | 481.26 |
| IUPAC Name | 2-acetyloxyethyl-[10-[2-acetyloxyethyl(dimethyl)azaniumyl]decyl]-dimethylazanium bromide |
| SMILES | CC(=O)OCC[N+](C)(C)CCCCCCCCCC[N+](C)(C)CCOC(C)=O.[Br-] |
| InChI | InChI=1S/C22H46N2O4.BrH/c1-21(25)27-19-17-23(3,4)15-13-11-9-7-8-10-12-14-16-24(5,6)18-20-28-22(2)26;/h7-20H2,1-6H3;1H/q+2;/p-1 |
| InChIKey | YMDMRNXTKATGRD-UHFFFAOYSA-M |
| XLogP | 0.39 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.52 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|