C13H23O8P — CID 58971329
[3-[2,2-bis(hydroxymethyl)-3-(2-methylprop-2-enoyloxy)propoxy]-3-oxopropyl]-methylphosphinic acid (PubChem CID 58971329) has the molecular formula C13H23O8P and a molecular weight of 338.29 g/mol. Its IUPAC name is [3-[2,2-bis(hydroxymethyl)-3-(2-methylprop-2-enoyloxy)propoxy]-3-oxopropyl]-methylphosphinic acid.
| Compound Name | [3-[2,2-bis(hydroxymethyl)-3-(2-methylprop-2-enoyloxy)propoxy]-3-oxopropyl]-methylphosphinic acid |
|---|---|
| PubChem CID | 58971329 |
| Molecular Formula | C13H23O8P |
| Molecular Weight | 338.29 g/mol |
| Exact Mass | 338.11 |
| IUPAC Name | [3-[2,2-bis(hydroxymethyl)-3-(2-methylprop-2-enoyloxy)propoxy]-3-oxopropyl]-methylphosphinic acid |
| SMILES | C=C(C)C(=O)OCC(CO)(CO)COC(=O)CCP(C)(=O)O |
| InChI | InChI=1S/C13H23O8P/c1-10(2)12(17)21-9-13(6-14,7-15)8-20-11(16)4-5-22(3,18)19/h14-15H,1,4-9H2,2-3H3,(H,18,19) |
| InChIKey | OFAFZKQSZQQOAJ-UHFFFAOYSA-N |
| XLogP | -0.09 |
| TPSA | 130.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.29 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|