C14H25O7P — CID 58971330
ethyl-[3-[2-(hydroxymethyl)-2-methyl-3-(2-methylprop-2-enoyloxy)propoxy]-3-oxopropyl]phosphinic acid (PubChem CID 58971330) has the molecular formula C14H25O7P and a molecular weight of 336.32 g/mol. Its IUPAC name is ethyl-[3-[2-(hydroxymethyl)-2-methyl-3-(2-methylprop-2-enoyloxy)propoxy]-3-oxopropyl]phosphinic acid.
| Compound Name | ethyl-[3-[2-(hydroxymethyl)-2-methyl-3-(2-methylprop-2-enoyloxy)propoxy]-3-oxopropyl]phosphinic acid |
|---|---|
| PubChem CID | 58971330 |
| Molecular Formula | C14H25O7P |
| Molecular Weight | 336.32 g/mol |
| Exact Mass | 336.13 |
| IUPAC Name | ethyl-[3-[2-(hydroxymethyl)-2-methyl-3-(2-methylprop-2-enoyloxy)propoxy]-3-oxopropyl]phosphinic acid |
| SMILES | C=C(C)C(=O)OCC(C)(CO)COC(=O)CCP(=O)(O)CC |
| InChI | InChI=1S/C14H25O7P/c1-5-22(18,19)7-6-12(16)20-9-14(4,8-15)10-21-13(17)11(2)3/h15H,2,5-10H2,1,3-4H3,(H,18,19) |
| InChIKey | ZFAQNBMNKSTAOV-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 110.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.32 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|