C12H17ClO5 — CID 88836789
[2-(3-chloroprop-2-enoyloxymethyl)-3-hydroxy-2-methylpropyl] 2-methylprop-2-enoate (PubChem CID 88836789) has the molecular formula C12H17ClO5 and a molecular weight of 276.72 g/mol. Its IUPAC name is [2-(3-chloroprop-2-enoyloxymethyl)-3-hydroxy-2-methylpropyl] 2-methylprop-2-enoate.
| Compound Name | [2-(3-chloroprop-2-enoyloxymethyl)-3-hydroxy-2-methylpropyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 88836789 |
| Molecular Formula | C12H17ClO5 |
| Molecular Weight | 276.72 g/mol |
| Exact Mass | 276.08 |
| IUPAC Name | [2-(3-chloroprop-2-enoyloxymethyl)-3-hydroxy-2-methylpropyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCC(C)(CO)COC(=O)C=CCl |
| InChI | InChI=1S/C12H17ClO5/c1-9(2)11(16)18-8-12(3,6-14)7-17-10(15)4-5-13/h4-5,14H,1,6-8H2,2-3H3 |
| InChIKey | CIBWALDCTNLHSB-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.72 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|