About [3-hydroxy-2-(7-hydroxyheptanoyloxymethyl)-2-methylpropyl] 7-hydroxyheptanoate
[3-hydroxy-2-(7-hydroxyheptanoyloxymethyl)-2-methylpropyl] 7-hydroxyheptanoate (PubChem CID 101287126) has the molecular formula C19H36O7
and a molecular weight of 376.49 g/mol. Its IUPAC name is [3-hydroxy-2-(7-hydroxyheptanoyloxymethyl)-2-methylpropyl] 7-hydroxyheptanoate.
Molecular Properties
| Compound Name | [3-hydroxy-2-(7-hydroxyheptanoyloxymethyl)-2-methylpropyl] 7-hydroxyheptanoate |
| PubChem CID | 101287126 |
| Molecular Formula | C19H36O7 |
| Molecular Weight | 376.49 g/mol |
| Exact Mass | 376.25 |
| IUPAC Name | [3-hydroxy-2-(7-hydroxyheptanoyloxymethyl)-2-methylpropyl] 7-hydroxyheptanoate |
| SMILES | CC(CO)(COC(=O)CCCCCCO)COC(=O)CCCCCCO |
| InChI | InChI=1S/C19H36O7/c1-19(14-22,15-25-17(23)10-6-2-4-8-12-20)16-26-18(24)11-7-3-5-9-13-21/h20-22H,2-16H2,1H3 |
| InChIKey | IDRLIJNTUHCCCH-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 113.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 376.49 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze [3-hydroxy-2-(7-hydroxyheptanoyloxymethyl)-2-methylpropyl] 7-hydroxyheptanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-hydroxy-2-(7-hydroxyheptanoyloxymethyl)-2-methylpropyl] 7-hydroxyheptanoate?
The IUPAC name of [3-hydroxy-2-(7-hydroxyheptanoyloxymethyl)-2-methylpropyl] 7-hydroxyheptanoate (CID 101287126) is [3-hydroxy-2-(7-hydroxyheptanoyloxymethyl)-2-methylpropyl] 7-hydroxyheptanoate.
What is the SMILES notation for [3-hydroxy-2-(7-hydroxyheptanoyloxymethyl)-2-methylpropyl] 7-hydroxyheptanoate?
The canonical SMILES for [3-hydroxy-2-(7-hydroxyheptanoyloxymethyl)-2-methylpropyl] 7-hydroxyheptanoate is CC(CO)(COC(=O)CCCCCCO)COC(=O)CCCCCCO.
What is the InChIKey of [3-hydroxy-2-(7-hydroxyheptanoyloxymethyl)-2-methylpropyl] 7-hydroxyheptanoate?
The InChIKey is IDRLIJNTUHCCCH-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H36O7/c1-19(14-22,15-25-17(23)10-6-2-4-8-12-20)16-26-18(24)11-7-3-5-9-13-21/h20-22H,2-16H2,1H3.
What are the key properties of [3-hydroxy-2-(7-hydroxyheptanoyloxymethyl)-2-methylpropyl] 7-hydroxyheptanoate?
[3-hydroxy-2-(7-hydroxyheptanoyloxymethyl)-2-methylpropyl] 7-hydroxyheptanoate has a molecular weight of 376.49 g/mol, XLogP of 1.96, 17 rotatable bonds, 3 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [3-hydroxy-2-(7-hydroxyheptanoyloxymethyl)-2-methylpropyl] 7-hydroxyheptanoate is sourced from PubChem (CID 101287126), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).