About [3-hydroxy-2-(hydroxymethyl)-2-methylpropyl] octanoate
[3-hydroxy-2-(hydroxymethyl)-2-methylpropyl] octanoate (PubChem CID 54006493) has the molecular formula C13H26O4
and a molecular weight of 246.35 g/mol. Its IUPAC name is [3-hydroxy-2-(hydroxymethyl)-2-methylpropyl] octanoate.
Molecular Properties
| Compound Name | [3-hydroxy-2-(hydroxymethyl)-2-methylpropyl] octanoate |
| PubChem CID | 54006493 |
| Molecular Formula | C13H26O4 |
| Molecular Weight | 246.35 g/mol |
| Exact Mass | 246.18 |
| IUPAC Name | [3-hydroxy-2-(hydroxymethyl)-2-methylpropyl] octanoate |
| SMILES | CCCCCCCC(=O)OCC(C)(CO)CO |
| InChI | InChI=1S/C13H26O4/c1-3-4-5-6-7-8-12(16)17-11-13(2,9-14)10-15/h14-15H,3-11H2,1-2H3 |
| InChIKey | KPFZNPDRATYDIP-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.35 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze [3-hydroxy-2-(hydroxymethyl)-2-methylpropyl] octanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-hydroxy-2-(hydroxymethyl)-2-methylpropyl] octanoate?
The IUPAC name of [3-hydroxy-2-(hydroxymethyl)-2-methylpropyl] octanoate (CID 54006493) is [3-hydroxy-2-(hydroxymethyl)-2-methylpropyl] octanoate.
What is the SMILES notation for [3-hydroxy-2-(hydroxymethyl)-2-methylpropyl] octanoate?
The canonical SMILES for [3-hydroxy-2-(hydroxymethyl)-2-methylpropyl] octanoate is CCCCCCCC(=O)OCC(C)(CO)CO.
What is the InChIKey of [3-hydroxy-2-(hydroxymethyl)-2-methylpropyl] octanoate?
The InChIKey is KPFZNPDRATYDIP-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H26O4/c1-3-4-5-6-7-8-12(16)17-11-13(2,9-14)10-15/h14-15H,3-11H2,1-2H3.
What are the key properties of [3-hydroxy-2-(hydroxymethyl)-2-methylpropyl] octanoate?
[3-hydroxy-2-(hydroxymethyl)-2-methylpropyl] octanoate has a molecular weight of 246.35 g/mol, XLogP of 1.88, 10 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [3-hydroxy-2-(hydroxymethyl)-2-methylpropyl] octanoate is sourced from PubChem (CID 54006493), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).