C17H32O7 — CID 101287119
[3-hydroxy-2-(5-hydroxyhexanoyloxymethyl)-2-methylpropyl] 5-hydroxyhexanoate (PubChem CID 101287119) has the molecular formula C17H32O7 and a molecular weight of 348.44 g/mol. Its IUPAC name is [3-hydroxy-2-(5-hydroxyhexanoyloxymethyl)-2-methylpropyl] 5-hydroxyhexanoate.
| Compound Name | [3-hydroxy-2-(5-hydroxyhexanoyloxymethyl)-2-methylpropyl] 5-hydroxyhexanoate |
|---|---|
| PubChem CID | 101287119 |
| Molecular Formula | C17H32O7 |
| Molecular Weight | 348.44 g/mol |
| Exact Mass | 348.21 |
| IUPAC Name | [3-hydroxy-2-(5-hydroxyhexanoyloxymethyl)-2-methylpropyl] 5-hydroxyhexanoate |
| SMILES | CC(O)CCCC(=O)OCC(C)(CO)COC(=O)CCCC(C)O |
| InChI | InChI=1S/C17H32O7/c1-13(19)6-4-8-15(21)23-11-17(3,10-18)12-24-16(22)9-5-7-14(2)20/h13-14,18-20H,4-12H2,1-3H3 |
| InChIKey | YULQSTYIYDDDTL-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 113.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.44 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |