C13H24O4 — CID 88969482
[3-hydroxy-2-(hydroxymethyl)-2-methylpropyl] (Z)-oct-5-enoate (PubChem CID 88969482) has the molecular formula C13H24O4 and a molecular weight of 244.33 g/mol. Its IUPAC name is [3-hydroxy-2-(hydroxymethyl)-2-methylpropyl] (Z)-oct-5-enoate.
| Compound Name | [3-hydroxy-2-(hydroxymethyl)-2-methylpropyl] (Z)-oct-5-enoate |
|---|---|
| PubChem CID | 88969482 |
| Molecular Formula | C13H24O4 |
| Molecular Weight | 244.33 g/mol |
| Exact Mass | 244.17 |
| IUPAC Name | [3-hydroxy-2-(hydroxymethyl)-2-methylpropyl] (Z)-oct-5-enoate |
| SMILES | CC/C=C\CCCC(=O)OCC(C)(CO)CO |
| InChI | InChI=1S/C13H24O4/c1-3-4-5-6-7-8-12(16)17-11-13(2,9-14)10-15/h4-5,14-15H,3,6-11H2,1-2H3/b5-4- |
| InChIKey | XPKQTYAFCUKOMC-PLNGDYQASA-N |
| XLogP | 1.66 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.33 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|