C13H24O5 — CID 89323925
[3-hydroxy-2,2-bis(hydroxymethyl)propyl] (Z)-oct-5-enoate (PubChem CID 89323925) has the molecular formula C13H24O5 and a molecular weight of 260.33 g/mol. Its IUPAC name is [3-hydroxy-2,2-bis(hydroxymethyl)propyl] (Z)-oct-5-enoate.
| Compound Name | [3-hydroxy-2,2-bis(hydroxymethyl)propyl] (Z)-oct-5-enoate |
|---|---|
| PubChem CID | 89323925 |
| Molecular Formula | C13H24O5 |
| Molecular Weight | 260.33 g/mol |
| Exact Mass | 260.16 |
| IUPAC Name | [3-hydroxy-2,2-bis(hydroxymethyl)propyl] (Z)-oct-5-enoate |
| SMILES | CC/C=C\CCCC(=O)OCC(CO)(CO)CO |
| InChI | InChI=1S/C13H24O5/c1-2-3-4-5-6-7-12(17)18-11-13(8-14,9-15)10-16/h3-4,14-16H,2,5-11H2,1H3/b4-3- |
| InChIKey | RMDOLZFUTJUAHM-ARJAWSKDSA-N |
| XLogP | 0.63 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.33 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|