C18H32O6 — CID 139246899
[3-hydroxy-2-(hydroxymethyl)-2-methylpropyl] (Z)-7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-methylcyclopentyl]hept-5-enoate (PubChem CID 139246899) has the molecular formula C18H32O6 and a molecular weight of 344.45 g/mol. Its IUPAC name is [3-hydroxy-2-(hydroxymethyl)-2-methylpropyl] (Z)-7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-methylcyclopentyl]hept-5-enoate.
| Compound Name | [3-hydroxy-2-(hydroxymethyl)-2-methylpropyl] (Z)-7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-methylcyclopentyl]hept-5-enoate |
|---|---|
| PubChem CID | 139246899 |
| Molecular Formula | C18H32O6 |
| Molecular Weight | 344.45 g/mol |
| Exact Mass | 344.22 |
| IUPAC Name | [3-hydroxy-2-(hydroxymethyl)-2-methylpropyl] (Z)-7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-methylcyclopentyl]hept-5-enoate |
| SMILES | C[C@@H]1[C@@H](C/C=C\CCCC(=O)OCC(C)(CO)CO)[C@@H](O)C[C@H]1O |
| InChI | InChI=1S/C18H32O6/c1-13-14(16(22)9-15(13)21)7-5-3-4-6-8-17(23)24-12-18(2,10-19)11-20/h3,5,13-16,19-22H,4,6-12H2,1-2H3/b5-3-/t13-,14-,15-,16+/m1/s1 |
| InChIKey | PPUPXXQAEUDVJZ-KMTXMSQWSA-N |
| XLogP | 1.01 |
| TPSA | 107.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.45 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|