C12H22O5 — CID 90713784
(3-formyloxy-2,2-dimethylpropyl) 6-hydroxyhexanoate (PubChem CID 90713784) has the molecular formula C12H22O5 and a molecular weight of 246.30 g/mol. Its IUPAC name is (3-formyloxy-2,2-dimethylpropyl) 6-hydroxyhexanoate.
| Compound Name | (3-formyloxy-2,2-dimethylpropyl) 6-hydroxyhexanoate |
|---|---|
| PubChem CID | 90713784 |
| Molecular Formula | C12H22O5 |
| Molecular Weight | 246.30 g/mol |
| Exact Mass | 246.15 |
| IUPAC Name | (3-formyloxy-2,2-dimethylpropyl) 6-hydroxyhexanoate |
| SMILES | CC(C)(COC=O)COC(=O)CCCCCO |
| InChI | InChI=1S/C12H22O5/c1-12(2,8-16-10-14)9-17-11(15)6-4-3-5-7-13/h10,13H,3-9H2,1-2H3 |
| InChIKey | JIFSLMUULMXLJF-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.30 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|