C23H31BrO10 — CID 59248547
1-O-(2-bromoethyl) 4-O-[3-(2-methylprop-2-enoyloxy)-2,2-bis(2-methylprop-2-enoyloxymethyl)propyl] butanedioate (PubChem CID 59248547) has the molecular formula C23H31BrO10 and a molecular weight of 547.40 g/mol. Its IUPAC name is 1-O-(2-bromoethyl) 4-O-[3-(2-methylprop-2-enoyloxy)-2,2-bis(2-methylprop-2-enoyloxymethyl)propyl] butanedioate.
| Compound Name | 1-O-(2-bromoethyl) 4-O-[3-(2-methylprop-2-enoyloxy)-2,2-bis(2-methylprop-2-enoyloxymethyl)propyl] butanedioate |
|---|---|
| PubChem CID | 59248547 |
| Molecular Formula | C23H31BrO10 |
| Molecular Weight | 547.40 g/mol |
| Exact Mass | 546.11 |
| IUPAC Name | 1-O-(2-bromoethyl) 4-O-[3-(2-methylprop-2-enoyloxy)-2,2-bis(2-methylprop-2-enoyloxymethyl)propyl] butanedioate |
| SMILES | C=C(C)C(=O)OCC(COC(=O)CCC(=O)OCCBr)(COC(=O)C(=C)C)COC(=O)C(=C)C |
| InChI | InChI=1S/C23H31BrO10/c1-15(2)20(27)32-12-23(13-33-21(28)16(3)4,14-34-22(29)17(5)6)11-31-19(26)8-7-18(25)30-10-9-24/h1,3,5,7-14H2,2,4,6H3 |
| InChIKey | VXQFJNDTMVSJAC-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 131.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.40 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|