C24H42O6 — CID 66984673
tris(3-methylbutyl) cyclohexane-1,2,4-tricarboxylate (PubChem CID 66984673) has the molecular formula C24H42O6 and a molecular weight of 426.59 g/mol. Its IUPAC name is tris(3-methylbutyl) cyclohexane-1,2,4-tricarboxylate.
| Compound Name | tris(3-methylbutyl) cyclohexane-1,2,4-tricarboxylate |
|---|---|
| PubChem CID | 66984673 |
| Molecular Formula | C24H42O6 |
| Molecular Weight | 426.59 g/mol |
| Exact Mass | 426.30 |
| IUPAC Name | tris(3-methylbutyl) cyclohexane-1,2,4-tricarboxylate |
| SMILES | CC(C)CCOC(=O)C1CCC(C(=O)OCCC(C)C)C(C(=O)OCCC(C)C)C1 |
| InChI | InChI=1S/C24H42O6/c1-16(2)9-12-28-22(25)19-7-8-20(23(26)29-13-10-17(3)4)21(15-19)24(27)30-14-11-18(5)6/h16-21H,7-15H2,1-6H3 |
| InChIKey | ZMZHHPWZDJMXEX-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.59 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|