C16H28O5 — CID 66983923
1-O-(2-hydroxyethyl) 3-O-(4-methylpentyl) cyclohexane-1,3-dicarboxylate (PubChem CID 66983923) has the molecular formula C16H28O5 and a molecular weight of 300.39 g/mol. Its IUPAC name is 1-O-(2-hydroxyethyl) 3-O-(4-methylpentyl) cyclohexane-1,3-dicarboxylate.
| Compound Name | 1-O-(2-hydroxyethyl) 3-O-(4-methylpentyl) cyclohexane-1,3-dicarboxylate |
|---|---|
| PubChem CID | 66983923 |
| Molecular Formula | C16H28O5 |
| Molecular Weight | 300.39 g/mol |
| Exact Mass | 300.19 |
| IUPAC Name | 1-O-(2-hydroxyethyl) 3-O-(4-methylpentyl) cyclohexane-1,3-dicarboxylate |
| SMILES | CC(C)CCCOC(=O)C1CCCC(C(=O)OCCO)C1 |
| InChI | InChI=1S/C16H28O5/c1-12(2)5-4-9-20-15(18)13-6-3-7-14(11-13)16(19)21-10-8-17/h12-14,17H,3-11H2,1-2H3 |
| InChIKey | TVKCMCIXBXLLPV-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.39 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|