C21H38O4 — CID 172819323
bis(4-methylpentyl) cycloheptane-1,3-dicarboxylate (PubChem CID 172819323) has the molecular formula C21H38O4 and a molecular weight of 354.53 g/mol. Its IUPAC name is bis(4-methylpentyl) cycloheptane-1,3-dicarboxylate.
| Compound Name | bis(4-methylpentyl) cycloheptane-1,3-dicarboxylate |
|---|---|
| PubChem CID | 172819323 |
| Molecular Formula | C21H38O4 |
| Molecular Weight | 354.53 g/mol |
| Exact Mass | 354.28 |
| IUPAC Name | bis(4-methylpentyl) cycloheptane-1,3-dicarboxylate |
| SMILES | CC(C)CCCOC(=O)C1CCCCC(C(=O)OCCCC(C)C)C1 |
| InChI | InChI=1S/C21H38O4/c1-16(2)9-7-13-24-20(22)18-11-5-6-12-19(15-18)21(23)25-14-8-10-17(3)4/h16-19H,5-15H2,1-4H3 |
| InChIKey | TZWQYGRQCZRQTD-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.53 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|