C10H16N2O6 — CID 18175371
2-(2-methylprop-2-enoylperoxy)ethyl 2-acetamido-2-aminoacetate (PubChem CID 18175371) has the molecular formula C10H16N2O6 and a molecular weight of 260.25 g/mol. Its IUPAC name is 2-(2-methylprop-2-enoylperoxy)ethyl 2-acetamido-2-aminoacetate.
| Compound Name | 2-(2-methylprop-2-enoylperoxy)ethyl 2-acetamido-2-aminoacetate |
|---|---|
| PubChem CID | 18175371 |
| Molecular Formula | C10H16N2O6 |
| Molecular Weight | 260.25 g/mol |
| Exact Mass | 260.10 |
| IUPAC Name | 2-(2-methylprop-2-enoylperoxy)ethyl 2-acetamido-2-aminoacetate |
| SMILES | C=C(C)C(=O)OOCCOC(=O)C(N)NC(C)=O |
| InChI | InChI=1S/C10H16N2O6/c1-6(2)9(14)18-17-5-4-16-10(15)8(11)12-7(3)13/h8H,1,4-5,11H2,2-3H3,(H,12,13) |
| InChIKey | DWFRHPOYPSZARZ-UHFFFAOYSA-N |
| XLogP | -1.00 |
| TPSA | 116.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.25 |
| LogP ≤ 5 | -1.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|