C8H14O4 — CID 174827257
2-ethylperoxyethyl 2-methylprop-2-enoate (PubChem CID 174827257) has the molecular formula C8H14O4 and a molecular weight of 174.20 g/mol. Its IUPAC name is 2-ethylperoxyethyl 2-methylprop-2-enoate.
| Compound Name | 2-ethylperoxyethyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 174827257 |
| Molecular Formula | C8H14O4 |
| Molecular Weight | 174.20 g/mol |
| Exact Mass | 174.09 |
| IUPAC Name | 2-ethylperoxyethyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCOOCC |
| InChI | InChI=1S/C8H14O4/c1-4-11-12-6-5-10-8(9)7(2)3/h2,4-6H2,1,3H3 |
| InChIKey | PANKJRZECMONOI-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.20 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|